1-[3-(2,2-dimethylpropanoyl)-1,3-diazinan-1-yl]-2,2-dimethylpropan-1-one structure
|
Common Name | 1-[3-(2,2-dimethylpropanoyl)-1,3-diazinan-1-yl]-2,2-dimethylpropan-1-one | ||
|---|---|---|---|---|
| CAS Number | 116046-92-5 | Molecular Weight | 254.36800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[3-(2,2-dimethylpropanoyl)-1,3-diazinan-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H26N2O2 |
|---|---|
| Molecular Weight | 254.36800 |
| Exact Mass | 254.19900 |
| PSA | 40.62000 |
| LogP | 1.97280 |
| InChIKey | BIYNBZHGHRIYPI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)N1CCCN(C(=O)C(C)(C)C)C1 |
|
~32%
1-[3-(2,2-dimet... CAS#:116046-92-5 |
| Literature: Katritzky, Alan R.; Murugan, Ramiah; Luce, Hudson; Zerner, Michael; Ford, George P. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1987 , p. 1695 - 1700 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,3-dipivaloylhexahydropyrimidine |