1-amino-2-methyl-4-[(4-methylphenyl)amino]anthraquinone
Modify Date: 2025-09-12 12:11:59
![1-amino-2-methyl-4-[(4-methylphenyl)amino]anthraquinone Structure](https://image.chemsrc.com/caspic/314/116-77-8.png)
1-amino-2-methyl-4-[(4-methylphenyl)amino]anthraquinone structure
|
Common Name | 1-amino-2-methyl-4-[(4-methylphenyl)amino]anthraquinone | ||
|---|---|---|---|---|
| CAS Number | 116-77-8 | Molecular Weight | 342.39100 | |
| Density | 1.317g/cm3 | Boiling Point | 588.7ºC at 760mmHg | |
| Molecular Formula | C22H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 309.9ºC | |
| Name | 1-amino-2-methyl-4-(4-methylanilino)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.317g/cm3 |
|---|---|
| Boiling Point | 588.7ºC at 760mmHg |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.39100 |
| Flash Point | 309.9ºC |
| Exact Mass | 342.13700 |
| PSA | 72.19000 |
| LogP | 5.05880 |
| Vapour Pressure | 7.7E-14mmHg at 25°C |
| Index of Refraction | 1.713 |
| InChIKey | BYGSHXHLDPUXIF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Nc2cc(C)c(N)c3c2C(=O)c2ccccc2C3=O)cc1 |
| HS Code | 2922399090 |
|---|
|
~%
1-amino-2-methy... CAS#:116-77-8 |
|
Literature: German Dyestuffs and Dyestuff Intermediates Fiat Final Report Nr. 1313, Bd. II |
|
~%
1-amino-2-methy... CAS#:116-77-8 |
| Literature: BASF Patent: DE131873 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 6, p. 407 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-AMINO-2-METHYL-4-[(4-METHYLPHENYL)AMINO]ANTHRAQUINONE |
| 1-Amino-2-methyl-4-p-toluidino-anthrachinon |
| 1-amino-2-methyl-4-[(4-methylphenyl)amino]-9,10-anthracenedione |
| 1-amino-2-methyl-4-p-toluidino-anthraquinone |
| EINECS 204-157-8 |