1,4-bis[(2,4,6-triethylphenyl)amino]anthraquinone structure
|
Common Name | 1,4-bis[(2,4,6-triethylphenyl)amino]anthraquinone | ||
|---|---|---|---|---|
| CAS Number | 116-74-5 | Molecular Weight | 558.75200 | |
| Density | 1.144g/cm3 | Boiling Point | 647.5ºC at 760mmHg | |
| Molecular Formula | C38H42N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.4ºC | |
| Name | 1,4-bis(2,4,6-triethylanilino)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.144g/cm3 |
|---|---|
| Boiling Point | 647.5ºC at 760mmHg |
| Molecular Formula | C38H42N2O2 |
| Molecular Weight | 558.75200 |
| Flash Point | 126.4ºC |
| Exact Mass | 558.32500 |
| PSA | 58.20000 |
| LogP | 9.46960 |
| Vapour Pressure | 1.19E-16mmHg at 25°C |
| Index of Refraction | 1.634 |
| InChIKey | ODDMIDRERDTWDF-UHFFFAOYSA-N |
| SMILES | CCc1cc(CC)c(Nc2ccc(Nc3c(CC)cc(CC)cc3CC)c3c2C(=O)c2ccccc2C3=O)c(CC)c1 |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| einecs 204-154-1 |