2,4-Bis(trifluoroacetyl)-1-(N,N-dimethylamino)naphthalene
Modify Date: 2025-08-26 12:56:55
2,4-Bis(trifluoroacetyl)-1-(N,N-dimethylamino)naphthalene structure
|
Common Name | 2,4-Bis(trifluoroacetyl)-1-(N,N-dimethylamino)naphthalene | ||
|---|---|---|---|---|
| CAS Number | 115975-33-2 | Molecular Weight | 363.25400 | |
| Density | 1.411g/cm3 | Boiling Point | 408.6ºC at 760mmHg | |
| Molecular Formula | C16H11F6NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.9ºC | |
| Name | 1-[4-(dimethylamino)-3-(2,2,2-trifluoroacetyl)naphthalen-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.411g/cm3 |
|---|---|
| Boiling Point | 408.6ºC at 760mmHg |
| Molecular Formula | C16H11F6NO2 |
| Molecular Weight | 363.25400 |
| Flash Point | 200.9ºC |
| Exact Mass | 363.06900 |
| PSA | 37.38000 |
| LogP | 4.39580 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | LUIHEIKCAQBALE-UHFFFAOYSA-N |
| SMILES | CN(C)c1c(C(=O)C(F)(F)F)cc(C(=O)C(F)(F)F)c2ccccc12 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2922399090 |
|
~99%
2,4-Bis(trifluo... CAS#:115975-33-2 |
| Literature: Okada, Etsuji; Masuda, Ryoichi; Hojo, Masaru; Tomifuji, Takeshi Heterocycles, 1993 , vol. 36, # 4 p. 845 - 856 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N,N-dimethyl-2,4-bistrifuoroacetyl-1-naphthylamine |
| N,N-Dimethyl-2,4-bistrifluoroacetyl-1-naphthylamine |