CAY10606 structure
|
Common Name | CAY10606 | ||
|---|---|---|---|---|
| CAS Number | 1159576-98-3 | Molecular Weight | 379.836 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 624.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C22H18ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 331.3±31.5 °C | |
| Name | ethyl 2-[(3-chlorophenyl)methyl]-5-hydroxy-1H-benzo[g]indole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 624.2±55.0 °C at 760 mmHg |
| Molecular Formula | C22H18ClNO3 |
| Molecular Weight | 379.836 |
| Flash Point | 331.3±31.5 °C |
| Exact Mass | 379.097534 |
| PSA | 62.32000 |
| LogP | 6.15 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.705 |
| InChIKey | UNDGVXYIMIZWAS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(Cc2cccc(Cl)c2)[nH]c2c1cc(O)c1ccccc12 |
|
~53%
CAY10606 CAS#:1159576-98-3 |
| Literature: Karg, Eva-Maria; Luderer, Susann; Pergola, Carlo; Buehring, Ulrike; Rossi, Antonietta; Northoff, Hinnak; Sautebin, Lidia; Troschuetz, Reinhard; Werz, Oliver Journal of Medicinal Chemistry, 2009 , vol. 52, # 11 p. 3474 - 3483 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Ethyl 2-(3-chlorobenzyl)-5-hydroxy-1H-benzo[g]indole-3-carboxylate |
| 1H-Benz[g]indole-3-carboxylic acid, 2-[(3-chlorophenyl)methyl]-5-hydroxy-, ethyl ester |