2-Thiopheneboronic acid MIDA ester structure
|
Common Name | 2-Thiopheneboronic acid MIDA ester | ||
|---|---|---|---|---|
| CAS Number | 1158984-92-9 | Molecular Weight | 239.05600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10BNO4S | Melting Point | 189-194℃ | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [2,2'-(Methylimino-κN)diacetato-κO(2-)](2-thienyl)boro |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 189-194℃ |
|---|---|
| Molecular Formula | C9H10BNO4S |
| Molecular Weight | 239.05600 |
| Exact Mass | 239.04200 |
| PSA | 93.20000 |
| InChIKey | FQBHBVFIFLJVGV-UHFFFAOYSA-N |
| SMILES | C[N+]12CC(=O)O[B-]1(c1cccs1)OC(=O)C2 |
| HS Code | 2934999090 |
|---|
|
~78%
2-Thiopheneboro... CAS#:1158984-92-9 |
| Literature: THE BOARD OF TRUSTEES OF THE UNIVERSITY OF ILLINOIS; BURKE, Martin, D.; KNAPP, David, M.; GILLIS, Eric, P. Patent: WO2010/36921 A2, 2010 ; Location in patent: Page/Page column 35 ; |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-thiophene-amidoxime |
| 2-thiophenyl MIDA boronate |
| 2-thienyl-MIDA boronate |
| N'-Hydroxy-2-thiophenecarbimide amide |
| thiophene-2-carboxylic acid-(amide oxime ) |
| 2-thiophenamidoxime |
| 2-thiopheneboronic acid MIDA ester |
| Thiophen-2-carbonsaeure-(amid-oxim) |
| (2-thienyl)B(N-methyliminodiacetate) |
| 2-Thiophenecarboximidamide,N-hydroxy |
| N-hydroxythiophene-2-carboximidamide |
| N'-hydroxy-2-thiophenecarboximidamide (en) |
| MIDA-boronate of thienyl-2-boronic acid |
| 2-Thiophenecarboximidamide,N-hydroxy-(9CI) |
| N-hydroxy-thiophene-2-carboximidic acid amide |