[4-(3-hydroxypropyl)piperidin-1-yl]-phenylmethanone structure
|
Common Name | [4-(3-hydroxypropyl)piperidin-1-yl]-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 115482-69-4 | Molecular Weight | 247.33300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [4-(3-hydroxypropyl)piperidin-1-yl]-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H21NO2 |
|---|---|
| Molecular Weight | 247.33300 |
| Exact Mass | 247.15700 |
| PSA | 40.54000 |
| LogP | 2.24920 |
| InChIKey | OKYVFTBOZSPEHL-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)N1CCC(CCCO)CC1 |
|
~93%
[4-(3-hydroxypr... CAS#:115482-69-4 |
| Literature: Ruggles, Christopher J.; Halpern, Arthur M. Journal of the American Chemical Society, 1988 , vol. 110, # 17 p. 5692 - 5698 |
|
~%
[4-(3-hydroxypr... CAS#:115482-69-4 |
| Literature: Adam, Solange Tetrahedron, 1994 , vol. 50, # 11 p. 3327 - 3332 |
| 4-Piperidinepropanol,1-benzoyl |
| N-benzoyl-4-piperidinepropanol |