N-Methyl-N-(2-(4-aminophenoxy)ethyl)-2-(4-aminophenyl)ethanamine structure
|
Common Name | N-Methyl-N-(2-(4-aminophenoxy)ethyl)-2-(4-aminophenyl)ethanamine | ||
|---|---|---|---|---|
| CAS Number | 115256-13-8 | Molecular Weight | 285.384 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 488.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C17H23N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.1±27.3 °C | |
| Name | 4-[2-[2-(4-aminophenoxy)ethyl-methylamino]ethyl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 488.3±40.0 °C at 760 mmHg |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.384 |
| Flash Point | 249.1±27.3 °C |
| Exact Mass | 285.184113 |
| PSA | 64.51000 |
| LogP | 1.39 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | QZYRUZJJDBUKII-UHFFFAOYSA-N |
| SMILES | CN(CCOc1ccc(N)cc1)CCc1ccc(N)cc1 |
| HS Code | 2922299090 |
|---|
|
~69%
N-Methyl-N-(2-(... CAS#:115256-13-8 |
| Literature: Cross; Arrowsmith; Thomas; Gwilt; Burges; Higgins Journal of Medicinal Chemistry, 1990 , vol. 33, # 4 p. 1151 - 1155 |
|
~%
N-Methyl-N-(2-(... CAS#:115256-13-8 |
| Literature: Journal of Medicinal Chemistry, , vol. 33, # 4 p. 1151 - 1155 |
|
~%
N-Methyl-N-(2-(... CAS#:115256-13-8 |
| Literature: Journal of Medicinal Chemistry, , vol. 33, # 4 p. 1151 - 1155 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Methyl-N-(2-(4-aminophenoxy)ethyl)-2-(4-aminophenyl)ehtanamine |
| N-Methyl-N-(2-(4-aminophenoxy)ethyl)-2-(4-aminophenyl)ethanamine |
| FC1322 |
| 1-(4-aminophenoxy)-2-[N-(4-aminophenethyl)-N-mathylamino]ethane |
| Benzeneethanamine, 4-amino-N-[2-(4-aminophenoxy)ethyl]-N-methyl- |
| 4-(2-{[2-(4-Aminophenoxy)ethyl](methyl)amino}ethyl)aniline |
| N-Methyl-N-[2-(4-aminophenoxy)ethyl]-4-aminophenethylamine |
| 1-(4-aminophenoxy)-2-[N-(4-aminophenethyl)-N-methylamino]ethane |