2-chloro-9-[(3,4-dichlorophenyl)methyl]-N,N-dimethylpurin-6-amine structure
|
Common Name | 2-chloro-9-[(3,4-dichlorophenyl)methyl]-N,N-dimethylpurin-6-amine | ||
|---|---|---|---|---|
| CAS Number | 115204-65-4 | Molecular Weight | 356.63800 | |
| Density | 1.52g/cm3 | Boiling Point | 499.5ºC at 760mmHg | |
| Molecular Formula | C14H12Cl3N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.9ºC | |
| Name | 2-chloro-9-[(3,4-dichlorophenyl)methyl]-N,N-dimethylpurin-6-amine |
|---|
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 499.5ºC at 760mmHg |
| Molecular Formula | C14H12Cl3N5 |
| Molecular Weight | 356.63800 |
| Flash Point | 255.9ºC |
| Exact Mass | 355.01600 |
| PSA | 46.84000 |
| LogP | 3.90080 |
| Vapour Pressure | 4.14E-10mmHg at 25°C |
| Index of Refraction | 1.693 |
| InChIKey | UXZRHGZAUJYLRH-UHFFFAOYSA-N |
| SMILES | CN(C)c1nc(Cl)nc2c1ncn2Cc1ccc(Cl)c(Cl)c1 |
|
~9%
2-chloro-9-[(3,... CAS#:115204-65-4 |
| Literature: Kelley, James L.; Linn, James A.; Krochmal, Mark P.; Selway, J. W. T. Journal of Medicinal Chemistry, 1988 , vol. 31, # 10 p. 2001 - 2004 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |