2-chloro-9-[(3-iodophenyl)methyl]-N,N-dimethylpurin-6-amine structure
|
Common Name | 2-chloro-9-[(3-iodophenyl)methyl]-N,N-dimethylpurin-6-amine | ||
|---|---|---|---|---|
| CAS Number | 115204-63-2 | Molecular Weight | 413.64400 | |
| Density | 1.77g/cm3 | Boiling Point | 513.5ºC at 760mmHg | |
| Molecular Formula | C14H13ClIN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.3ºC | |
| Name | 2-chloro-9-[(3-iodophenyl)methyl]-N,N-dimethylpurin-6-amine |
|---|
| Density | 1.77g/cm3 |
|---|---|
| Boiling Point | 513.5ºC at 760mmHg |
| Molecular Formula | C14H13ClIN5 |
| Molecular Weight | 413.64400 |
| Flash Point | 264.3ºC |
| Exact Mass | 412.99000 |
| PSA | 46.84000 |
| LogP | 3.19860 |
| Vapour Pressure | 1.18E-10mmHg at 25°C |
| Index of Refraction | 1.732 |
| InChIKey | NWPDNIKYEKZPBE-UHFFFAOYSA-N |
| SMILES | CN(C)c1nc(Cl)nc2c1ncn2Cc1cccc(I)c1 |
|
~74%
2-chloro-9-[(3-... CAS#:115204-63-2 |
| Literature: Kelley, James L.; Linn, James A.; Krochmal, Mark P.; Selway, J. W. T. Journal of Medicinal Chemistry, 1988 , vol. 31, # 10 p. 2001 - 2004 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |