N-[4-[4-(benzenesulfonamido)phenyl]sulfonylphenyl]benzenesulfonamide structure
|
Common Name | N-[4-[4-(benzenesulfonamido)phenyl]sulfonylphenyl]benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 115166-66-0 | Molecular Weight | 528.62000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H20N2O6S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[4-[4-(benzenesulfonamido)phenyl]sulfonylphenyl]benzenesulfonamide |
|---|
| Molecular Formula | C24H20N2O6S3 |
|---|---|
| Molecular Weight | 528.62000 |
| Exact Mass | 528.04800 |
| PSA | 151.62000 |
| LogP | 7.50940 |
| InChIKey | NOGXUWORMKAUIT-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Nc1ccc(S(=O)(=O)c2ccc(NS(=O)(=O)c3ccccc3)cc2)cc1)c1ccccc1 |
|
~%
N-[4-[4-(benzen... CAS#:115166-66-0 |
| Literature: Heymann; Fieser Journal of the American Chemical Society, 1945 , vol. 67, p. 1979,1985 |
|
~%
N-[4-[4-(benzen... CAS#:115166-66-0 |
| Literature: Heymann; Fieser Journal of the American Chemical Society, 1945 , vol. 67, p. 1979,1985 |
|
~%
N-[4-[4-(benzen... CAS#:115166-66-0 |
| Literature: Heymann; Fieser Journal of the American Chemical Society, 1945 , vol. 67, p. 1979,1985 |