methyl 3,5-ditert-butyl-4-methoxybenzoate structure
|
Common Name | methyl 3,5-ditert-butyl-4-methoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 115126-97-1 | Molecular Weight | 278.38700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 3,5-ditert-butyl-4-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H26O3 |
|---|---|
| Molecular Weight | 278.38700 |
| Exact Mass | 278.18800 |
| PSA | 35.53000 |
| LogP | 4.07680 |
| InChIKey | CQHWTFRZWJFWEH-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(C(C)(C)C)c(OC)c(C(C)(C)C)c1 |
|
~%
methyl 3,5-dite... CAS#:115126-97-1 |
| Literature: Snutch, Terrance P.; Zamponi, Gerald W.; Pajouhesh, Hassan; Belardetti, Francesco; Pajouhesh, Hossein Patent: US2004/266784 A1, 2004 ; US 20040266784 A1 |
|
~%
methyl 3,5-dite... CAS#:115126-97-1 |
| Literature: Galemmo, JR., Robert; Holland, Richard; Hum, Gabriel; Pajouhesh, Hossein; Chahal, Navjot; Seid-Bagherzadeh, Mehran; Girard, Amy Patent: US2009/270394 A1, 2009 ; Location in patent: Page/Page column 9 ; US 20090270394 A1 |
|
~%
methyl 3,5-dite... CAS#:115126-97-1 |
| Literature: Pastor, Stephen D.; Hessell, Edward T. Journal of Organometallic Chemistry, 1987 , vol. 328, p. 263 - 274 |
|
~%
methyl 3,5-dite... CAS#:115126-97-1 |
| Literature: Pastor, Stephen D.; Hessell, Edward T. Journal of Organometallic Chemistry, 1987 , vol. 328, p. 263 - 274 |
| 3,5-di-tert-butyl-4-methoxy-benzoic acid methyl ester |
| methyl 3,5-di-t-butyl-4-methoxybenzoate |