Desmethylxanthohumol structure
|
Common Name | Desmethylxanthohumol | ||
|---|---|---|---|---|
| CAS Number | 115063-39-3 | Molecular Weight | 340.37000 | |
| Density | 1.312g/cm3 | Boiling Point | 570.7ºC at 760mmHg | |
| Molecular Formula | C20H20O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 313ºC | |
Use of DesmethylxanthohumolDesmethylxanthohumol is a prenylated hydroxychalcone isolated from hop cones (Humulus lupulus L.). Desmethylxanthohumol is a powerful apoptosis inducing agent. Desmethylxanthohumol has antiplasmodial, antiproliferative, and antioxidant bioactivities[1][2]. |
| Name | desmethylxanthohumol |
|---|---|
| Synonym | More Synonyms |
| Description | Desmethylxanthohumol is a prenylated hydroxychalcone isolated from hop cones (Humulus lupulus L.). Desmethylxanthohumol is a powerful apoptosis inducing agent. Desmethylxanthohumol has antiplasmodial, antiproliferative, and antioxidant bioactivities[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.312g/cm3 |
|---|---|
| Boiling Point | 570.7ºC at 760mmHg |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.37000 |
| Flash Point | 313ºC |
| Exact Mass | 340.13100 |
| PSA | 97.99000 |
| LogP | 3.91380 |
| Vapour Pressure | 1.26E-13mmHg at 25°C |
| Index of Refraction | 1.679 |
| InChIKey | FUSADYLVRMROPL-UXBLZVDNSA-N |
| SMILES | CC(C)=CCc1c(O)cc(O)c(C(=O)C=Cc2ccc(O)cc2)c1O |
| Storage condition | 2-8℃ |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| Demethylxanthohumol |
| 2',4',6',4-tetrahydroxy-3-C-prenylchalcone |
| 2',4',6',4-tetrahydroxy-3'-prenylchalcone |
| 2',4,4',6'-tetrahydroxy-3'-(3-methyl-2-butenyl)chalcone |
| Desmethylxanthohumol |
| (E)-3-(4-hydroxyphenyl)-1-[2,4,6-trihydroxy-3-(3-methylbut-2-enyl)phenyl]prop-2-en-1-one |
| 2',4',6',4-tetrahydrooxy-3-C-prenylchalcone |