Soyasaponin Ba structure
|
Common Name | Soyasaponin Ba | ||
|---|---|---|---|---|
| CAS Number | 114590-20-4 | Molecular Weight | 959.122 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 1054.6±65.0 °C at 760 mmHg | |
| Molecular Formula | C48H78O19 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 300.1±27.8 °C | |
Use of Soyasaponin BaSoyasaponin Ba is a soyasaponin isolated from Phaseolus vulgaris, acts as an aldose reductase inhibitors (ARI)[1]. |
| Name | (3β,22β)-22,24-Dihydroxyolean-12-en-3-yl β-D-glucopyranosyl-(1->2)-β-D-galactopyranosyl-(1->2)-β-D-glucopyranosiduronic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Soyasaponin Ba is a soyasaponin isolated from Phaseolus vulgaris, acts as an aldose reductase inhibitors (ARI)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 1054.6±65.0 °C at 760 mmHg |
| Molecular Formula | C48H78O19 |
| Molecular Weight | 959.122 |
| Flash Point | 300.1±27.8 °C |
| Exact Mass | 958.513733 |
| PSA | 315.21000 |
| LogP | 5.85 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | WFRQIKSNAYYUJZ-BKQVBUAGSA-N |
| SMILES | CC1(C)CC(O)C2(C)CCC3(C)C(=CCC4C5(C)CCC(OC6OC(C(=O)O)C(O)C(O)C6OC6OC(CO)C(O)C(O)C6OC6OC(CO)C(O)C(O)C6O)C(C)(CO)C5CCC43C)C2C1 |
| Storage condition | 2-8℃ |
| β-D-Glucopyranosiduronic acid, (3β,22β)-22,24-dihydroxyolean-12-en-3-yl O-β-D-glucopyranosyl-(1->2)-O-β-D-galactopyranosyl-(1->2)- |
| (3β,22β)-22,24-Dihydroxyolean-12-en-3-yl β-D-glucopyranosyl-(1->2)-β-D-galactopyranosyl-(1->2)-β-D-glucopyranosiduronic acid |