[3-(aminomethyl)phenyl]methanamine,diphenyl benzene-1,3-dicarboxylate,hexane-1,6-diamine
Modify Date: 2024-09-16 14:13:49
![[3-(aminomethyl)phenyl]methanamine,diphenyl benzene-1,3-dicarboxylate,hexane-1,6-diamine Structure](https://image.chemsrc.com/caspic/172/114535-87-4.png)
[3-(aminomethyl)phenyl]methanamine,diphenyl benzene-1,3-dicarboxylate,hexane-1,6-diamine structure
|
Common Name | [3-(aminomethyl)phenyl]methanamine,diphenyl benzene-1,3-dicarboxylate,hexane-1,6-diamine | ||
|---|---|---|---|---|
| CAS Number | 114535-87-4 | Molecular Weight | 570.72200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H42N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [3-(aminomethyl)phenyl]methanamine,diphenyl benzene-1,3-dicarboxylate,hexane-1,6-diamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C34H42N4O4 |
|---|---|
| Molecular Weight | 570.72200 |
| Exact Mass | 570.32100 |
| PSA | 156.68000 |
| LogP | 7.99440 |
| InChIKey | WSGYORVIKQOFPQ-UHFFFAOYSA-N |
| SMILES | NCCCCCCN.NCc1cccc(CN)c1.O=C(Oc1ccccc1)c1cccc(C(=O)Oc2ccccc2)c1 |
| 1,3-Benzenedicarboxylic acid,diphenyl ester,polymer with 1,3-benzenedimethanamine and 1,6-hexanediamine |
| 1,3-Benzenedicarboxylic acid,1,3-diphenyl ester,polymer with 1,3-benzenedimethanamine and 1,6-hexanediamine |