N'-(2-aminoethyl)ethane-1,2-diamine,diphenyl benzene-1,3-dicarboxylate,hexane-1,6-diamine structure
|
Common Name | N'-(2-aminoethyl)ethane-1,2-diamine,diphenyl benzene-1,3-dicarboxylate,hexane-1,6-diamine | ||
|---|---|---|---|---|
| CAS Number | 114535-86-3 | Molecular Weight | 537.69400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H43N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N'-(2-aminoethyl)ethane-1,2-diamine,diphenyl benzene-1,3-dicarboxylate,hexane-1,6-diamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C30H43N5O4 |
|---|---|
| Molecular Weight | 537.69400 |
| Exact Mass | 537.33200 |
| PSA | 168.71000 |
| LogP | 6.27470 |
| InChIKey | JSKMAKNNXSBEOQ-UHFFFAOYSA-N |
| SMILES | NCCCCCCN.NCCNCCN.O=C(Oc1ccccc1)c1cccc(C(=O)Oc2ccccc2)c1 |
| 1,3-Benzenedicarboxylic acid,diphenyl ester,polymer with N-(2-aminoethyl)-1,2-ethanediamine and 1,6-hexanediamine |
| 1,3-Benzenedicarboxylic acid,1,3-diphenyl ester,polymer with N1-(2-aminoethyl)-1,2-ethanediamine and 1,6-hexanediamine |