LUF5771 structure
|
Common Name | LUF5771 | ||
|---|---|---|---|---|
| CAS Number | 1141802-49-4 | Molecular Weight | 357.44 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of LUF5771LUF5771 is a potent allosteric recombinant luteinizing hormone (recLH) and Org 43553 inhibitor. LUF5771 is able to partially activate the LH receptor with low efficacy[1]. |
| Name | LUF5771 |
|---|
| Description | LUF5771 is a potent allosteric recombinant luteinizing hormone (recLH) and Org 43553 inhibitor. LUF5771 is able to partially activate the LH receptor with low efficacy[1]. |
|---|---|
| Related Catalog | |
| Target |
recLH and Org 43553[1] |
| In Vitro | LUF5771 (1 µM or 10 µM) allosteric inhibition is concentration-dependent. LUF5771 significantly increases radioligand dissociation. LUF5771 probably binds to the seven transmembrane domain like Org 43553 does. LUF5771 (10 µM) alone is able to partially activate the LH receptor by 31±4%[1]. |
| References |
| Molecular Formula | C24H23NO2 |
|---|---|
| Molecular Weight | 357.44 |
| InChIKey | YNYOWRRXJIPCGX-UHFFFAOYSA-N |
| SMILES | O=C(NC1CCCC1)Oc1cc(-c2ccccc2)cc(-c2ccccc2)c1 |