1-[diethoxyphosphoryl(methylsulfanyl)methyl]-2-methylbenzene structure
|
Common Name | 1-[diethoxyphosphoryl(methylsulfanyl)methyl]-2-methylbenzene | ||
|---|---|---|---|---|
| CAS Number | 114100-03-7 | Molecular Weight | 288.34300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H21O3PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[diethoxyphosphoryl(methylsulfanyl)methyl]-2-methylbenzene |
|---|
| Molecular Formula | C13H21O3PS |
|---|---|
| Molecular Weight | 288.34300 |
| Exact Mass | 288.09500 |
| PSA | 70.64000 |
| LogP | 4.62270 |
| InChIKey | LTGHACLDGQJMID-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)C(SC)c1ccccc1C |
|
~%
1-[diethoxyphos... CAS#:114100-03-7 |
| Literature: Ishibashi, Hiroyuki; Sato, Tatsunori; Irie, Maki; Ito, Masae; Ikeda, Masazumi Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1987 , p. 1095 - 1098 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |