Amlodipine besilate impurity D structure
|
Common Name | Amlodipine besilate impurity D | ||
|---|---|---|---|---|
| CAS Number | 113994-41-5 | Molecular Weight | 406.860 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 517.9±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H23ClN2O5 | Melting Point | 106-108ºC | |
| MSDS | N/A | Flash Point | 267.0±30.1 °C | |
Use of Amlodipine besilate impurity DAmlodipine besilate impurity D is a biochemical. |
| Name | 3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-6-methylpyridine-3,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 517.9±50.0 °C at 760 mmHg |
| Melting Point | 106-108ºC |
| Molecular Formula | C20H23ClN2O5 |
| Molecular Weight | 406.860 |
| Flash Point | 267.0±30.1 °C |
| Exact Mass | 406.129547 |
| PSA | 100.74000 |
| LogP | 3.25 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.562 |
| InChIKey | APZSGEHAFPIYQZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(COCCN)nc(C)c(C(=O)OC)c1-c1ccccc1Cl |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| UNII-38Q8451QLU |
| 3-ethyl-5-methyl-2-[((aminoethyl)-oxy)methyl]-4-(2-chlorophenyl)-6-methylpyridine-3,5-dicarboxylate |
| 3,5-Pyridinedicarboxylicacid,2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-6-methyl-,3-ethyl 5-methylester |
| Dehydro Amlodipine |
| 2-(2-aminoethoxy)methyl-3-ethoxycarbonyl-4-(o-chlorophenyl)-5-methoxycarbonyl-6-methylpyridine |
| 2-(2-Amino-ethoxymethyl)-4-(2-chloro-phenyl)-6-methyl-pyridine-3,5-dicarboxylic acid 3-ethyl ester 5-methyl ester |
| 3,5-Pyridinedicarboxylic acid, 2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-6-methyl-, 3-ethyl 5-methyl ester |
| 2-(aminoethoxy)methyl-4-(2-chlorophenyl)-3-ethoxycarbonyl-5-methoxycarbonyl-6-methylpyridine |
| 3-Ethyl 5-methyl 2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-6-methyl-3,5-pyridinedicarboxylate |
| 2-[(2-AMINOETHOXY)METHYL]-4-(2-CHLOROPHENYL)-6-METHYL-3,5-PYRIDINEDICARBOXYLIC ACID 3-ETHYL 5-METHYL ESTER |
| Amlodipine Impurity 4 |