5-decylthiophene-2-carboxylic acid structure
|
Common Name | 5-decylthiophene-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 113953-39-2 | Molecular Weight | 268.41500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H24O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-decylthiophene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H24O2S |
|---|---|
| Molecular Weight | 268.41500 |
| Exact Mass | 268.15000 |
| PSA | 65.54000 |
| LogP | 5.12950 |
| InChIKey | TZNUMPAEXGQNJH-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCc1ccc(C(=O)O)s1 |
|
~%
5-decylthiophen... CAS#:113953-39-2 |
| Literature: Wynberg; Logothetis Journal of the American Chemical Society, 1956 , vol. 78, p. 1958,1960 |
|
~%
5-decylthiophen... CAS#:113953-39-2 |
| Literature: Wynberg; Logothetis Journal of the American Chemical Society, 1956 , vol. 78, p. 1958,1960 |
|
~%
5-decylthiophen... CAS#:113953-39-2 |
| Literature: Wynberg; Logothetis Journal of the American Chemical Society, 1956 , vol. 78, p. 1958,1960 |
| 5-decyl-thiophene-2-carboxylic acid |
| 5-Decyl-thiophen-2-carbonsaeure |
| 5-Decyl-2-thiophenecarboxylic acid |
| 2-Thiophenecarboxylic acid,5-decyl |