1-(4-chlorophenyl)sulfonyl-3-propan-2-ylurea,piperidine
Modify Date: 2025-08-23 14:22:58
1-(4-chlorophenyl)sulfonyl-3-propan-2-ylurea,piperidine structure
|
Common Name | 1-(4-chlorophenyl)sulfonyl-3-propan-2-ylurea,piperidine | ||
|---|---|---|---|---|
| CAS Number | 113712-88-2 | Molecular Weight | 361.88700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H24ClN3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-chlorophenyl)sulfonyl-3-propan-2-ylurea,piperidine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H24ClN3O3S |
|---|---|
| Molecular Weight | 361.88700 |
| Exact Mass | 361.12300 |
| PSA | 99.17000 |
| LogP | 4.50110 |
| Vapour Pressure | 8.98E-10mmHg at 25°C |
| InChIKey | LPMWNXOVOPQMHA-UHFFFAOYSA-N |
| SMILES | C1CCNCC1.CC(C)NC(=O)NS(=O)(=O)c1ccc(Cl)cc1 |
| 4-Chloro-N-(((1-methylethyl)amino)carbonyl)benzenesulfonamide compd. with piperidine (1:1) |
| Benzenesulfonamide,4-chloro-N-(((1-methylethyl)amino)carbonyl)-,compd. with piperidine (1:1) |