2-amino-2-(3,5-dichlorophenyl)acetic acid hydrochloride
Modify Date: 2025-08-25 15:58:58
2-amino-2-(3,5-dichlorophenyl)acetic acid hydrochloride structure
|
Common Name | 2-amino-2-(3,5-dichlorophenyl)acetic acid hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1137014-87-9 | Molecular Weight | 256.51400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8Cl3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-2-(3,5-dichlorophenyl)acetic acid,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H8Cl3NO2 |
|---|---|
| Molecular Weight | 256.51400 |
| Exact Mass | 254.96200 |
| PSA | 63.32000 |
| LogP | 3.58010 |
| InChIKey | CPQMVIKDRJMUKS-UHFFFAOYSA-N |
| SMILES | Cl.NC(C(=O)O)c1cc(Cl)cc(Cl)c1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| MFCD06202321 |