(5-chloro-3-methyl-1-phenyl-pyrazol-4-yl)methanol structure
|
Common Name | (5-chloro-3-methyl-1-phenyl-pyrazol-4-yl)methanol | ||
|---|---|---|---|---|
| CAS Number | 1136-60-3 | Molecular Weight | 222.67100 | |
| Density | 1.28g/cm3 | Boiling Point | 378.5ºC at 760 mmHg | |
| Molecular Formula | C11H11ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.7ºC | |
| Name | (5-chloro-3-methyl-1-phenylpyrazol-4-yl)methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 378.5ºC at 760 mmHg |
| Molecular Formula | C11H11ClN2O |
| Molecular Weight | 222.67100 |
| Flash Point | 182.7ºC |
| Exact Mass | 222.05600 |
| PSA | 38.05000 |
| LogP | 2.32640 |
| Vapour Pressure | 2.11E-06mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | MOMLHNYGSVMETK-UHFFFAOYSA-N |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1CO |
| HS Code | 2933199090 |
|---|
|
~61%
(5-chloro-3-met... CAS#:1136-60-3 |
| Literature: E. R. Squibb and Sons, Inc. Patent: US4248881 A1, 1981 ; |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-chloro-4-hydroxymethyl-3-methyl-1-phenylpyrazole |
| 5-Chlor-3-methyl-4-hydroxymethyl-1-phenyl-pyrazol |