1-Keto Ketorolac
Modify Date: 2025-09-21 09:26:33
1-Keto Ketorolac structure
|
Common Name | 1-Keto Ketorolac | ||
|---|---|---|---|---|
| CAS Number | 113502-52-6 | Molecular Weight | 225.243 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 427.9±33.0 °C at 760 mmHg | |
| Molecular Formula | C14H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.6±25.4 °C | |
| Name | 5-benzoyl-2,3-dihydropyrrolizin-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 427.9±33.0 °C at 760 mmHg |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.243 |
| Flash Point | 212.6±25.4 °C |
| Exact Mass | 225.078979 |
| PSA | 39.07000 |
| LogP | 2.35 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.653 |
| InChIKey | NFKBMHXYCKRXPQ-UHFFFAOYSA-N |
| SMILES | O=C1CCn2c1ccc2C(=O)c1ccccc1 |
| RIDADR | NONH for all modes of transport |
|---|
| 1H-Pyrrolizin-1-one, 5-benzoyl-2,3-dihydro- |
| 5-Benzoyl-2,3-dihydro-1H-pyrrolizin-1-one |
| 1-Keto Ketorolac |
| 1H-Pyrrolizin-1-one,5-benzoyl-2,3-dihydro |
| Ketorolac Impurity 4 |