1-Aziridineethanol,b-ethyl-b-methyl-a-phenyl-
Modify Date: 2024-09-15 18:57:35
1-Aziridineethanol,b-ethyl-b-methyl-a-phenyl- structure
|
Common Name | 1-Aziridineethanol,b-ethyl-b-methyl-a-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 1135-63-3 | Molecular Weight | 205.29600 | |
| Density | 1.103g/cm3 | Boiling Point | 309.7ºC at 760mmHg | |
| Molecular Formula | C13H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.6ºC | |
| Name | 2-(aziridin-1-yl)-2-methyl-1-phenylbutan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.103g/cm3 |
|---|---|
| Boiling Point | 309.7ºC at 760mmHg |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.29600 |
| Flash Point | 137.6ºC |
| Exact Mass | 205.14700 |
| PSA | 23.24000 |
| LogP | 2.14220 |
| Vapour Pressure | 0.000271mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | XLWZBTOYPSSQQV-UHFFFAOYSA-N |
| SMILES | CCC(C)(C(O)c1ccccc1)N1CC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-aziridin-1-yl-2-methyl-1-phenyl-butan-1-ol |
| 1-Aziridineethanol,b-ethyl-b-methyl-a-phenyl |
| 1-Phenyl-2-<1-aziridinyl>-2-methyl-butanol |