2,2-dimethyl-3,10-dihydropyrano[2,3-b]carbazol-4-one structure
|
Common Name | 2,2-dimethyl-3,10-dihydropyrano[2,3-b]carbazol-4-one | ||
|---|---|---|---|---|
| CAS Number | 113425-43-7 | Molecular Weight | 265.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2-dimethyl-3,10-dihydropyrano[2,3-b]carbazol-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H15NO2 |
|---|---|
| Molecular Weight | 265.30700 |
| Exact Mass | 265.11000 |
| PSA | 42.09000 |
| LogP | 4.06490 |
| InChIKey | RNPBIIYWKJXPKI-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)c2cc3c(cc2O1)[nH]c1ccccc13 |
|
~%
2,2-dimethyl-3,... CAS#:113425-43-7 |
| Literature: Chakraborty; Roy; Dutta Journal of the Indian Chemical Society, 1987 , vol. 64, # 4 p. 215 - 217 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Pyrano[2,3-b]carbazol-4(10H)-one,2,3-dihydro-2,2-dimethyl |