(3-Chloro-4-nitrophenyl)methanol structure
|
Common Name | (3-Chloro-4-nitrophenyl)methanol | ||
|---|---|---|---|---|
| CAS Number | 113372-68-2 | Molecular Weight | 187.580 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 351.2±27.0 °C at 760 mmHg | |
| Molecular Formula | C7H6ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.2±23.7 °C | |
| Name | 3-chloro-4-nitrobenzyl alcohol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 351.2±27.0 °C at 760 mmHg |
| Molecular Formula | C7H6ClNO3 |
| Molecular Weight | 187.580 |
| Flash Point | 166.2±23.7 °C |
| Exact Mass | 187.003616 |
| PSA | 66.05000 |
| LogP | 1.15 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | ZJVGZPXKLAORCY-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(CO)cc1Cl |
|
~56%
(3-Chloro-4-nit... CAS#:113372-68-2 |
| Literature: Silk, Nicholas A.; Martin, Carl N. Journal of Chemical Research, Miniprint, 1987 , # 8 p. 2133 - 2139 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| Benzenemethanol, 3-chloro-4-nitro- |
| 3-Chloro-4-nitro-benzenemethanol |
| (3-Chloro-4-nitrophenyl)methanol |