Nicorandil-d4 structure
|
Common Name | Nicorandil-d4 | ||
|---|---|---|---|---|
| CAS Number | 1132681-23-2 | Molecular Weight | 215.19900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5D4N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Nicorandil-d4Nicorandil-d4 (SG-75-d4) is the deuterium labeled Nicorandil. Nicorandil (SG-75) is a potent potassium channel activator and targets vascular nucleoside diphosphate-dependent K+ channels and cardiac ATP-sensitive K+ channels (KATP). Nicorandil is a nicotinamide ester with vasodilatory and cardioprotective effects and has the potential for angina and forischemic heart diseases[1][2][3]. |
| Name | 2-(nicotinamido-2,4,5,6-d4)ethyl nitrate |
|---|
| Description | Nicorandil-d4 (SG-75-d4) is the deuterium labeled Nicorandil. Nicorandil (SG-75) is a potent potassium channel activator and targets vascular nucleoside diphosphate-dependent K+ channels and cardiac ATP-sensitive K+ channels (KATP). Nicorandil is a nicotinamide ester with vasodilatory and cardioprotective effects and has the potential for angina and forischemic heart diseases[1][2][3]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C8H5D4N3O4 |
|---|---|
| Molecular Weight | 215.19900 |
| Exact Mass | 215.08400 |
| PSA | 97.04000 |
| LogP | 0.93380 |
| InChIKey | LBHIOVVIQHSOQN-VTBMLFEUSA-N |
| SMILES | O=C(NCCO[N+](=O)[O-])c1cccnc1 |