6-methyl-6-(2-phenylethyl)oxan-2-one structure
|
Common Name | 6-methyl-6-(2-phenylethyl)oxan-2-one | ||
|---|---|---|---|---|
| CAS Number | 113235-07-7 | Molecular Weight | 218.29200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-methyl-6-(2-phenylethyl)oxan-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H18O2 |
|---|---|
| Molecular Weight | 218.29200 |
| Exact Mass | 218.13100 |
| PSA | 26.30000 |
| LogP | 3.10500 |
| InChIKey | JRRQMXHHEODRHP-UHFFFAOYSA-N |
| SMILES | CC1(CCc2ccccc2)CCCC(=O)O1 |
|
~66%
6-methyl-6-(2-p... CAS#:113235-07-7 |
| Literature: Gansaeuer, Andreas; Bluhm, Harald; Pierobon, Marianna Journal of the American Chemical Society, 1998 , vol. 120, # 49 p. 12849 - 12859 |
|
~98%
6-methyl-6-(2-p... CAS#:113235-07-7 |
| Literature: Otsubo, Kenji; Kawamura, Kisa; Inanaga, Junji; Yamaguchi, Masaru Chemistry Letters, 1987 , p. 1487 - 1490 |
| 2H-Pyran-2-one,tetrahydro-6-methyl-6-(2-phenylethyl) |
| 6-methyl-6-phenethyltetrahydropyran-2-one |