2,4-Dichloro-7-(phenylsulfonyl)-7H-pyrrolo[2,3-d]pyrimidine structure
|
Common Name | 2,4-Dichloro-7-(phenylsulfonyl)-7H-pyrrolo[2,3-d]pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 1131992-22-7 | Molecular Weight | 328.17400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H7Cl2N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-Dichloro-7-(phenylsulfonyl)-7H-pyrrolo[2,3-d]pyrimidine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H7Cl2N3O2S |
|---|---|
| Molecular Weight | 328.17400 |
| Exact Mass | 326.96400 |
| PSA | 73.23000 |
| LogP | 4.05590 |
| InChIKey | ZGWRYMWYEXGDNI-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)n1ccc2c(Cl)nc(Cl)nc21 |
| HS Code | 2933990090 |
|---|
|
~91%
2,4-Dichloro-7-... CAS#:1131992-22-7 |
| Literature: VERNALIS (R and D) LTD. Patent: WO2009/37467 A1, 2009 ; Location in patent: Page/Page column 32-33; 15 ; WO 2009/037467 A1 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-aziridin-1-yl-6-methyl-quinoline-5,8-dione |