3-Bromo-4-(cyclohexylamino)benzoic acid
Modify Date: 2025-09-01 18:20:12
3-Bromo-4-(cyclohexylamino)benzoic acid structure
|
Common Name | 3-Bromo-4-(cyclohexylamino)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1131594-43-8 | Molecular Weight | 298.17600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Bromo-4-(cyclohexylamino)benzoic acid |
|---|
| Molecular Formula | C13H16BrNO2 |
|---|---|
| Molecular Weight | 298.17600 |
| Exact Mass | 297.03600 |
| PSA | 49.33000 |
| LogP | 3.96490 |
| InChIKey | GBERUJYYLAWYCV-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(NC2CCCCC2)c(Br)c1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |