Olmesartan Medoxomil-d6 structure
|
Common Name | Olmesartan Medoxomil-d6 | ||
|---|---|---|---|---|
| CAS Number | 1127298-67-2 | Molecular Weight | 564.62200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H24D6N6O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Olmesartan Medoxomil-d6Olmesartan medoxomil-d6 (CS 866-d6) is the deuterium labeled Olmesartan medoxomil. Olmesartan medoxomil is a potent and selective angiotensin AT1 receptor inhibitor with IC50 of 66.2 μM[1][2]. |
| Name | Olmesartan Medoxomil-d6 |
|---|
| Description | Olmesartan medoxomil-d6 (CS 866-d6) is the deuterium labeled Olmesartan medoxomil. Olmesartan medoxomil is a potent and selective angiotensin AT1 receptor inhibitor with IC50 of 66.2 μM[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C29H24D6N6O6 |
|---|---|
| Molecular Weight | 564.62200 |
| Exact Mass | 564.26000 |
| PSA | 162.16000 |
| LogP | 4.17000 |
| InChIKey | UQGKUQLKSCSZGY-LIJFRPJRSA-N |
| SMILES | CCCc1nc(C(C)(C)O)c(C(=O)OCc2oc(=O)oc2C)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |