2-(1-phenylpentyl)-2-prop-1-enylpropanedinitrile structure
|
Common Name | 2-(1-phenylpentyl)-2-prop-1-enylpropanedinitrile | ||
|---|---|---|---|---|
| CAS Number | 112654-16-7 | Molecular Weight | 252.35400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H20N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(1-phenylpentyl)-2-prop-1-enylpropanedinitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H20N2 |
|---|---|
| Molecular Weight | 252.35400 |
| Exact Mass | 252.16300 |
| PSA | 47.58000 |
| LogP | 4.57006 |
| InChIKey | ISRCQISMTDFVFQ-UHFFFAOYSA-N |
| SMILES | CC=CC(C#N)(C#N)C(CCCC)c1ccccc1 |
|
~62%
2-(1-phenylpent... CAS#:112654-16-7 |
| Literature: Journal of Organic Chemistry, , vol. 71, # 6 p. 2503 - 2506 |
|
~93%
2-(1-phenylpent... CAS#:112654-16-7 |
| Literature: Journal of the American Chemical Society, , vol. 110, # 4 p. 1288 - 1290 |
| Propanedinitrile,(1-phenylpentyl)-2-propenyl |