N-(5-methyl-1,2-oxazol-3-yl)-1-(4-nitrophenyl)methanimine structure
|
Common Name | N-(5-methyl-1,2-oxazol-3-yl)-1-(4-nitrophenyl)methanimine | ||
|---|---|---|---|---|
| CAS Number | 112633-39-3 | Molecular Weight | 231.20700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(5-methyl-1,2-oxazol-3-yl)-1-(4-nitrophenyl)methanimine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H9N3O3 |
|---|---|
| Molecular Weight | 231.20700 |
| Exact Mass | 231.06400 |
| PSA | 84.21000 |
| LogP | 3.16500 |
| InChIKey | FSNLLGSNBWLZNZ-UHFFFAOYSA-N |
| SMILES | Cc1cc(N=Cc2ccc([N+](=O)[O-])cc2)no1 |
|
~98%
N-(5-methyl-1,2... CAS#:112633-39-3 |
| Literature: Rajanarendar; Afzal; Ramu Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2003 , vol. 42, # 4 p. 927 - 930 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Isoxazolamine,5-methyl-N-[(4-nitrophenyl)methylene] |