N-(N-(phenyl)butyryl-L-prolyl)pyrrolidine structure
|
Common Name | N-(N-(phenyl)butyryl-L-prolyl)pyrrolidine | ||
|---|---|---|---|---|
| CAS Number | 112603-82-4 | Molecular Weight | 314.42200 | |
| Density | 1.156g/cm3 | Boiling Point | 534.3ºC at 760mmHg | |
| Molecular Formula | C19H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.5ºC | |
| Name | 4-phenyl-1-[(2S)-2-(pyrrolidine-1-carbonyl)pyrrolidin-1-yl]butan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.156g/cm3 |
|---|---|
| Boiling Point | 534.3ºC at 760mmHg |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.42200 |
| Flash Point | 243.5ºC |
| Exact Mass | 314.19900 |
| PSA | 40.62000 |
| LogP | 3.02010 |
| Vapour Pressure | 1.71E-11mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | HDRSLHFTJYMQIL-KRWDZBQOSA-N |
| SMILES | O=C(C1CCCN1C(=O)CCCc1ccccc1)N1CCCC1 |
|
~46%
N-(N-(phenyl)bu... CAS#:112603-82-4 |
| Literature: Yoshimoto; Tsuru; Yamamoto; Ikezawa; Furukawa Agricultural and biological chemistry, 1991 , vol. 55, # 1 p. 37 - 43 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Suam-1221 |
| 4-Phenylbutyryl-Pro-pyrrolidine |