Benzyl 4,5-bis(benzyloxy)picolinate
Benzyl 4,5-bis(benzyloxy)picolinate structure
|
Common Name | Benzyl 4,5-bis(benzyloxy)picolinate | ||
|---|---|---|---|---|
| CAS Number | 112334-42-6 | Molecular Weight | 425.47600 | |
| Density | 1.213g/cm3 | Boiling Point | 611.966ºC at 760 mmHg | |
| Molecular Formula | C27H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 323.905ºC | |
| Name | benzyl 4,5-bis(phenylmethoxy)pyridine-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.213g/cm3 |
|---|---|
| Boiling Point | 611.966ºC at 760 mmHg |
| Molecular Formula | C27H23NO4 |
| Molecular Weight | 425.47600 |
| Flash Point | 323.905ºC |
| Exact Mass | 425.16300 |
| PSA | 57.65000 |
| LogP | 5.59660 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | NNVNDLCNXISESU-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccccc1)c1cc(OCc2ccccc2)c(OCc2ccccc2)cn1 |
| HS Code | 2933399090 |
|---|
|
~31%
Benzyl 4,5-bis(... CAS#:112334-42-6 |
| Literature: US2010/160281 A1, ; Page/Page column 12-13 ; US 20100160281 A1 |
|
~%
Benzyl 4,5-bis(... CAS#:112334-42-6 |
| Literature: US4777252 A1, ; |
|
~%
Benzyl 4,5-bis(... CAS#:112334-42-6 |
| Literature: US4723002 A1, ; |
|
~%
Benzyl 4,5-bis(... CAS#:112334-42-6 |
| Literature: ACS Medicinal Chemistry Letters, , vol. 2, # 5 p. 385 - 390 |
|
~%
Benzyl 4,5-bis(... CAS#:112334-42-6 |
| Literature: ACS Medicinal Chemistry Letters, , vol. 2, # 5 p. 385 - 390 |
|
~%
Benzyl 4,5-bis(... CAS#:112334-42-6 |
| Literature: ACS Medicinal Chemistry Letters, , vol. 2, # 5 p. 385 - 390 |
CAS#:112334-46-0
CAS#:1229937-09-0| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| benzyl 4,5-bis(benzyloxy)pyridine-2-carboxylate |
| benzyl 4,5-bis(benzyloxy)picolinate |
| 4,5-Bis(phenylmethoxy)-2-pyridine-carboxylic acid,phenylmethylester |