Methyl 4-amino-3-bromo-5-fluorobenzoate structure
|
Common Name | Methyl 4-amino-3-bromo-5-fluorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 1123171-91-4 | Molecular Weight | 248.04900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7BrFNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 4-amino-3-bromo-5-fluorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H7BrFNO2 |
|---|---|
| Molecular Weight | 248.04900 |
| Exact Mass | 246.96400 |
| PSA | 52.32000 |
| LogP | 2.53820 |
| InChIKey | RDASOBRMXWNFNB-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(F)c(N)c(Br)c1 |
| HS Code | 2922499990 |
|---|
|
~%
Methyl 4-amino-... CAS#:1123171-91-4 |
| Literature: US2009/54427 A1, ; Page/Page column 15 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| methylaminobromofluorobenzoate |
| 4-amino-3-bromo-5-fluoro-benzoic acid methyl ester |