6-chloro-9-[(4-methoxyphenyl)methyl]purine structure
|
Common Name | 6-chloro-9-[(4-methoxyphenyl)methyl]purine | ||
|---|---|---|---|---|
| CAS Number | 112088-76-3 | Molecular Weight | 274.70600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11ClN4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-chloro-9-[(4-methoxyphenyl)methyl]purine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H11ClN4O |
|---|---|
| Molecular Weight | 274.70600 |
| Exact Mass | 274.06200 |
| PSA | 52.83000 |
| LogP | 2.53660 |
| InChIKey | JQNLSVGJRUOZMR-UHFFFAOYSA-N |
| SMILES | COc1ccc(Cn2cnc3c(Cl)ncnc32)cc1 |
|
~45%
6-chloro-9-[(4-... CAS#:112088-76-3 |
| Literature: Bakkestuen, Anne Kristin; Gundersen, Lise-Lotte; Utenova, Bibigul T. Journal of Medicinal Chemistry, 2005 , vol. 48, # 7 p. 2710 - 2723 |
|
~28%
6-chloro-9-[(4-... CAS#:112088-76-3 |
| Literature: Kelley, James L.; Krochmal, Mark P.; Linn, James A.; McLean, Ed W.; Soroko, Francis E. Journal of Medicinal Chemistry, 1988 , vol. 31, # 3 p. 606 - 612 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 6-chloro-9-(4-methoxybenzyl)purine |
| 6-chloro-9-(4-methoxyphenylmethyl)-9H-purine |
| 9H-Purine,6-chloro-9-[(4-methoxyphenyl)methyl] |
| 6-chloro-9-(4-methoxybenzyl)-9H-purine |