(2R)-3-{[tert-butyl(dimethyl)silyl]oxy}-2-methyl-1-propanol structure
|
Common Name | (2R)-3-{[tert-butyl(dimethyl)silyl]oxy}-2-methyl-1-propanol | ||
|---|---|---|---|---|
| CAS Number | 112057-64-4 | Molecular Weight | 204.38200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H24O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2R)-3-{[tert-butyl(dimethyl)silyl]oxy}-2-methyl-1-propanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H24O2Si |
|---|---|
| Molecular Weight | 204.38200 |
| Exact Mass | 204.15500 |
| PSA | 29.46000 |
| LogP | 2.63660 |
| InChIKey | OAWLYVJZJYEJSM-SECBINFHSA-N |
| SMILES | CC(CO)CO[Si](C)(C)C(C)(C)C |
|
~%
(2R)-3-{[tert-b... CAS#:112057-64-4 |
| Literature: Corey; Bo; Busch-Petersen Journal of the American Chemical Society, 1998 , vol. 120, # 49 p. 13000 - 13001 |
| Precursor 1 | |
|---|---|
| DownStream 10 | |
| .(2S)-3-(tert-butyldimethylsilyloxy)-2-methyl-propan-1-ol |
| .(2R)-3-[(tert-butyldimethylsilyl)oxy]-2-methylpropan-1-ol |
| .(R)-(+)-2-methyl-3-tert-butyldimethylsilyloxypropan-1-ol |
| .(R)-(+)-2-methyl-3-tert-butyldimethylsilyloxypropane-1-ol |
| (R)-3-(tert-butyl-dimethyl-silanyloxy)-2-methyl-propan-1-ol |
| .(2R)-3-(tert-butyldimethylsilanyloxy)-2-methylpropan-1-ol |