tris(trimethylsilyl)silylformaldehyde structure
|
Common Name | tris(trimethylsilyl)silylformaldehyde | ||
|---|---|---|---|---|
| CAS Number | 112044-12-9 | Molecular Weight | 276.67100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H28OSi4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tris(trimethylsilyl)silylformaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H28OSi4 |
|---|---|
| Molecular Weight | 276.67100 |
| Exact Mass | 276.12200 |
| PSA | 17.07000 |
| LogP | 4.05900 |
| InChIKey | FVCNHDHPUUUOHQ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)[Si](C=O)([Si](C)(C)C)[Si](C)(C)C |
|
~%
tris(trimethyls... CAS#:112044-12-9 |
| Literature: Elsner,F.H.; Woo,H.G.; Tilley,T.D. Journal of the American Chemical Society, 1988 , vol. 110, p. 313 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 2-Trisilanecarboxaldehyde,1,1,1,3,3,3-hexamethyl-2-(trimethylsilyl) |