(2E)-3-{4-Methoxy-3-[(2,2,2-trifluoroethoxy)-methyl]phenyl}acrylic acid
Modify Date: 2025-08-24 14:27:17
![(2E)-3-{4-Methoxy-3-[(2,2,2-trifluoroethoxy)-methyl]phenyl}acrylic acid Structure](https://image.chemsrc.com/caspic/168/1119452-77-5.png)
(2E)-3-{4-Methoxy-3-[(2,2,2-trifluoroethoxy)-methyl]phenyl}acrylic acid structure
|
Common Name | (2E)-3-{4-Methoxy-3-[(2,2,2-trifluoroethoxy)-methyl]phenyl}acrylic acid | ||
|---|---|---|---|---|
| CAS Number | 1119452-77-5 | Molecular Weight | 290.23500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13F3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2E)-3-{4-Methoxy-3-[(2,2,2-trifluoroethoxy)-methyl]phenyl}acrylic acid |
|---|
| Molecular Formula | C13H13F3O4 |
|---|---|
| Molecular Weight | 290.23500 |
| Exact Mass | 290.07700 |
| PSA | 55.76000 |
| LogP | 2.87190 |
| InChIKey | WNRMPDTUWWSIEU-HWKANZROSA-N |
| SMILES | COc1ccc(C=CC(=O)O)cc1COCC(F)(F)F |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |