N-(1-phenylethylcarbamothioyl)benzamide structure
|
Common Name | N-(1-phenylethylcarbamothioyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 111752-78-4 | Molecular Weight | 284.37600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(1-phenylethylcarbamothioyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H16N2OS |
|---|---|
| Molecular Weight | 284.37600 |
| Exact Mass | 284.09800 |
| PSA | 83.75000 |
| LogP | 4.03820 |
| InChIKey | LFNTYAFRRGFAEV-UHFFFAOYSA-N |
| SMILES | CC(NC(=S)NC(=O)c1ccccc1)c1ccccc1 |
|
~%
N-(1-phenylethy... CAS#:111752-78-4 |
| Literature: Brindley, Jocelyn C.; Caldwell, Jennifer M.; Meakins, G. Denis; Plackett, Simon J.; Price, Susan J. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1987 , p. 1153 - 1158 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-benzoyl-N'-(1-methylbenzyl)thiourea |
| Benzamide,N-[[(1-phenylethyl)amino]thioxomethyl] |
| N-benzoyl-N'-(1-phenylethyl)thiourea |