furan-2,5-dione,styrene,2,2,4-trimethylpent-4-enylazanium
Modify Date: 2025-11-19 16:00:55
furan-2,5-dione,styrene,2,2,4-trimethylpent-4-enylazanium structure
|
Common Name | furan-2,5-dione,styrene,2,2,4-trimethylpent-4-enylazanium | ||
|---|---|---|---|---|
| CAS Number | 111719-93-8 | Molecular Weight | 330.44100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H28NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | furan-2,5-dione,styrene,2,2,4-trimethylpent-4-enylazanium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H28NO3 |
|---|---|
| Molecular Weight | 330.44100 |
| Exact Mass | 330.20700 |
| PSA | 71.01000 |
| LogP | 3.17630 |
| InChIKey | FNAQSKPWMVSQAX-UHFFFAOYSA-O |
| SMILES | C=C(C)CC(C)(C)C[NH3+].C=Cc1ccccc1.O=C1C=CC(=O)O1 |
| 2,5-Furandione,polymer with ethenylbenzene and 2,4,4-trimethyl-1-pentene,ammonium salt |