1-(benzenesulfonyl)-5-cyclohexyloxypyrrolidin-2-one
Modify Date: 2025-09-05 12:12:40
1-(benzenesulfonyl)-5-cyclohexyloxypyrrolidin-2-one structure
|
Common Name | 1-(benzenesulfonyl)-5-cyclohexyloxypyrrolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 111711-87-6 | Molecular Weight | 323.40700 | |
| Density | 1.31g/cm3 | Boiling Point | 470.5ºC at 760mmHg | |
| Molecular Formula | C16H21NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.3ºC | |
| Name | 1-(benzenesulfonyl)-5-cyclohexyloxypyrrolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 470.5ºC at 760mmHg |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.40700 |
| Flash Point | 238.3ºC |
| Exact Mass | 323.11900 |
| PSA | 72.06000 |
| LogP | 3.69180 |
| Vapour Pressure | 5.04E-09mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | OBGKNAPKHCFUJO-UHFFFAOYSA-N |
| SMILES | O=C1CCC(OC2CCCCC2)N1S(=O)(=O)c1ccccc1 |
|
~%
1-(benzenesulfo... CAS#:111711-87-6 |
| Literature: Toja, E; Gorini, C; Zirotti, C; Barzaghi, F; Galliani, G European Journal of Medicinal Chemistry, 1991 , vol. 26, # 4 p. 403 - 413 |
|
~%
1-(benzenesulfo... CAS#:111711-87-6 |
| Literature: Toja, E; Gorini, C; Zirotti, C; Barzaghi, F; Galliani, G European Journal of Medicinal Chemistry, 1991 , vol. 26, # 4 p. 403 - 413 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 5-(Cyclohexyloxy)-1-(phenylsulfonyl)-2-pyrrolidinone |
| 2-Pyrrolidinone,5-(cyclohexyloxy)-1-(phenylsulfonyl) |