5-ethoxy-1-naphthalen-2-ylsulfonylpyrrolidin-2-one
Modify Date: 2025-09-25 21:48:10
5-ethoxy-1-naphthalen-2-ylsulfonylpyrrolidin-2-one structure
|
Common Name | 5-ethoxy-1-naphthalen-2-ylsulfonylpyrrolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 111711-63-8 | Molecular Weight | 319.37500 | |
| Density | 1.36g/cm3 | Boiling Point | 494.8ºC at 760 mmHg | |
| Molecular Formula | C16H17NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.1ºC | |
| Name | 5-ethoxy-1-naphthalen-2-ylsulfonylpyrrolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 494.8ºC at 760 mmHg |
| Molecular Formula | C16H17NO4S |
| Molecular Weight | 319.37500 |
| Flash Point | 253.1ºC |
| Exact Mass | 319.08800 |
| PSA | 72.06000 |
| LogP | 3.53220 |
| Vapour Pressure | 6.23E-10mmHg at 25°C |
| Index of Refraction | 1.644 |
| InChIKey | HDRBAFGMSGSRPZ-UHFFFAOYSA-N |
| SMILES | CCOC1CCC(=O)N1S(=O)(=O)c1ccc2ccccc2c1 |
|
~%
5-ethoxy-1-naph... CAS#:111711-63-8 |
| Literature: Toja, E; Gorini, C; Zirotti, C; Barzaghi, F; Galliani, G European Journal of Medicinal Chemistry, 1991 , vol. 26, # 4 p. 403 - 413 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-Ethoxy-1-(2-naphthalenylsulfonyl)-2-pyrrolidinone |
| 2-Pyrrolidinone,5-ethoxy-1-(2-naphthalenylsulfonyl) |