5-ethoxy-1-(3-nitrophenyl)sulfonylpyrrolidin-2-one
Modify Date: 2025-09-25 11:19:07
5-ethoxy-1-(3-nitrophenyl)sulfonylpyrrolidin-2-one structure
|
Common Name | 5-ethoxy-1-(3-nitrophenyl)sulfonylpyrrolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 111711-56-9 | Molecular Weight | 314.31400 | |
| Density | 1.48g/cm3 | Boiling Point | 474.5ºC at 760mmHg | |
| Molecular Formula | C12H14N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.8ºC | |
| Name | 5-ethoxy-1-(3-nitrophenyl)sulfonylpyrrolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 474.5ºC at 760mmHg |
| Molecular Formula | C12H14N2O6S |
| Molecular Weight | 314.31400 |
| Flash Point | 240.8ºC |
| Exact Mass | 314.05700 |
| PSA | 117.88000 |
| LogP | 2.81040 |
| Vapour Pressure | 3.6E-09mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | JROFIYHEFLZELH-UHFFFAOYSA-N |
| SMILES | CCOC1CCC(=O)N1S(=O)(=O)c1cccc([N+](=O)[O-])c1 |
|
~%
5-ethoxy-1-(3-n... CAS#:111711-56-9 |
| Literature: Toja, E; Gorini, C; Zirotti, C; Barzaghi, F; Galliani, G European Journal of Medicinal Chemistry, 1991 , vol. 26, # 4 p. 403 - 413 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-Ethoxy-1-((3-nitrophenyl)sulfonyl)-2-pyrrolidinone |
| 2-Pyrrolidinone,5-ethoxy-1-((3-nitrophenyl)sulfonyl) |