5-[(2-nitrophenyl)hydrazinylidene]-1,3-diazinane-2,4,6-trione structure
|
Common Name | 5-[(2-nitrophenyl)hydrazinylidene]-1,3-diazinane-2,4,6-trione | ||
|---|---|---|---|---|
| CAS Number | 111709-57-0 | Molecular Weight | 277.19300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7N5O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4,5,6(1H,3H)-Pyrimidinetetrone, 5-[(2-nitrophenyl)hydrazone] (en) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H7N5O5 |
|---|---|
| Molecular Weight | 277.19300 |
| Exact Mass | 277.04500 |
| PSA | 145.48000 |
| LogP | 0.98250 |
| InChIKey | RRMNJNNWGYZSSX-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(O)c(N=Nc2ccccc2[N+](=O)[O-])c(=O)[nH]1 |
|
~%
5-[(2-nitrophen... CAS#:111709-57-0 |
| Literature: Xue, Mengzhu; Xu, Minghao; Lu, Weiqiang; Huang, Jin; Li, Honglin; Xu, Yufang; Liu, Xiaofeng; Zhao, Zhenjiang Journal of Enzyme Inhibition and Medicinal Chemistry, 2013 , vol. 28, # 4 p. 747 - 752 |
|
~%
5-[(2-nitrophen... CAS#:111709-57-0 |
| Literature: Kuehling Chemische Berichte, 1898 , vol. 31, p. 1973 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2,4,5,6-Tetraoxypyrimidine |
| alloxane tetrahydrate |
| A6316_ALDRICH |
| Alloxan tetrahydrate |
| 5,6-Dioxyuracil |