diphenylgermanium,trimethylsilicon structure
|
Common Name | diphenylgermanium,trimethylsilicon | ||
|---|---|---|---|---|
| CAS Number | 111655-78-8 | Molecular Weight | 376.25000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H31GeSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diphenylgermanium,trimethylsilicon |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H31GeSi2 |
|---|---|
| Molecular Weight | 376.25000 |
| Exact Mass | 377.11800 |
| LogP | 5.29640 |
| InChIKey | GVCDCVBCRKDJSR-UHFFFAOYSA-N |
| SMILES | C[Si](C)C.C[Si](C)C.c1ccc([Ge]c2ccccc2)cc1 |
|
~39%
diphenylgermani... CAS#:111655-78-8 |
| Literature: Journal of Organometallic Chemistry, , vol. 341, p. C17 - C22 |
|
~58%
diphenylgermani... CAS#:111655-78-8 |
| Literature: Organometallics, , vol. 10, p. 2772 - 2777 |
|
~76%
diphenylgermani... CAS#:111655-78-8 |
| Literature: Canadian Journal of Chemistry, , vol. 83, # 9 p. 1324 - 1338 |
| Precursor 6 | |
|---|---|
| DownStream 5 | |
| Silane,(diphenylgermylene)bis[trimethyl |
| bis(trimethylsilyl)diphenylgermane |
| bis(trimethylsilyl)phenylgermane |