1-(5-(2,2,2-TRICHLOROACETYL)-1H-PYRROL-3-YL)PROPAN-1-ONE
Modify Date: 2025-08-25 15:22:42
1-(5-(2,2,2-TRICHLOROACETYL)-1H-PYRROL-3-YL)PROPAN-1-ONE structure
|
Common Name | 1-(5-(2,2,2-TRICHLOROACETYL)-1H-PYRROL-3-YL)PROPAN-1-ONE | ||
|---|---|---|---|---|
| CAS Number | 111468-90-7 | Molecular Weight | 268.52400 | |
| Density | 1.479g/cm3 | Boiling Point | 392.7ºC at 760mmHg | |
| Molecular Formula | C9H8Cl3NO2 | Melting Point | 190-192ºC | |
| MSDS | N/A | Flash Point | 191.3ºC | |
| Name | 1-[5-(2,2,2-trichloroacetyl)-1H-pyrrol-3-yl]propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.479g/cm3 |
|---|---|
| Boiling Point | 392.7ºC at 760mmHg |
| Melting Point | 190-192ºC |
| Molecular Formula | C9H8Cl3NO2 |
| Molecular Weight | 268.52400 |
| Flash Point | 191.3ºC |
| Exact Mass | 266.96200 |
| PSA | 49.93000 |
| LogP | 3.16030 |
| Vapour Pressure | 2.24E-06mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | LCPFRWWWCIWDTO-UHFFFAOYSA-N |
| SMILES | CCC(=O)c1c[nH]c(C(=O)C(Cl)(Cl)Cl)c1 |
| HS Code | 2933990090 |
|---|
|
~79%
1-(5-(2,2,2-TRI... CAS#:111468-90-7 |
| Literature: Garrido, Daniel O. A.; Buldain, Graciela; Ojea, Maria I.; Frydman, Benjamin Journal of Organic Chemistry, 1988 , vol. 53, # 2 p. 403 - 407 |
|
~%
1-(5-(2,2,2-TRI... CAS#:111468-90-7 |
| Literature: US2003/92714 A1, ; US 20030092714 A1 |
CAS#:111468-94-1| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Propanone,1-[5-(2,2,2-trichloroacetyl)-1H-pyrrol-3-yl] |
| trichloroacetylpyrrolylpropanone |
| 4-propionyl-2-(trichloroacetyl)pyrrole |
| 1-[5-(2,2,2-trichloro-acetyl)-1H-pyrrol-3-yl]-propan-1-one |