chloromethyl(triphenyl)phosphanium,bromide structure
|
Common Name | chloromethyl(triphenyl)phosphanium,bromide | ||
|---|---|---|---|---|
| CAS Number | 111441-95-3 | Molecular Weight | 391.66900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H17BrClP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | chloromethyl(triphenyl)phosphanium,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H17BrClP |
|---|---|
| Molecular Weight | 391.66900 |
| Exact Mass | 389.99400 |
| PSA | 13.59000 |
| LogP | 1.18080 |
| InChIKey | LYEZKQFUQDWRHV-UHFFFAOYSA-M |
| SMILES | ClC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
|
~40%
chloromethyl(tr... CAS#:111441-95-3 |
| Literature: Li, Xing-Ya; Hu, Jin-Shan Tetrahedron Letters, 1987 , vol. 28, # 50 p. 6317 - 6320 |
|
~%
chloromethyl(tr... CAS#:111441-95-3 |
| Literature: Seyferth,D. et al. Journal of the American Chemical Society, 1961 , vol. 83, p. 1617 - 1620 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| chloromethyl triphenylphosphonium bromide |
| Phosphonium,(chloromethyl)triphenyl-,bromide |
| Chlormethyl-triphenyl-phosphonium |
| PPh3(CH2Cl)Br |